pyruvate LCTONWCANYUPML-UHFFFAOYSA-M Beilstein:3587721 PMID:22311625 CHEBI:14987 C3H3O3 Gmelin:2502 PMID:21823181 CC(=O)C([O-])=O InChI=1S/C3H4O3/c1-2(4)3(5)6/h1H3,(H,5,6)/p-1 Reaxys:3587721 PMID:21854850 chebi_ontology PMID:22451307 -1 CHEBI:26462 PMID:22016370 PMID:22215378 87.00877 2-oxopropanoate UM-BBD_compID:c0159 pyruvate 2-oxopropanoic acid, ion(1-) CHEBI:15361 PMID:22006570 CAS:57-60-3 PMID:17190852 2-oxopropanoate PMID:22458763 A 2-oxo monocarboxylic acid anion that is the conjugate base of pyruvic acid, arising from deprotonation of the carboxy group. KEGG:C00022 87.05412 PMID:21603897 chalcogen molecular entity carbon group molecular entity polyatomic entity