cysteine 0 121.01975 121.161 cisteina knapsack:C00007323 Cystein chebi_ontology Cysteine wikipedia.en:Cysteine InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6) Cysteine C gmelin:2933 CHEBI:15356 NC(CS)C(=O)O pubmed:25181601 kegg.compound:C00736 2-amino-3-sulfanylpropanoic acid cysteine CHEBI:14061 CHEBI:4050 reaxys:1721406 cas:3374-22-9 2-amino-3-mercaptopropanoic acid knapsack:C00001351 Zystein C3H7NO2S CHEBI:23508 cysteine Cys 2-Amino-3-mercaptopropionic acid XUJNEKJLAYXESH-UHFFFAOYSA-N A sulfur-containing amino acid that is propanoic acid with an amino group at position 2 and a sulfanyl group at position 3. Hcys pubmed:17439666 organosulfur compound amino acid