catechol 3-O-methylgallic acid 0 184.03717 184.147 3-O-Methylgallic acid 3,4-dihydroxy-5-methoxybenzoic acid KWCCUYSXAYTNKA-UHFFFAOYSA-N 4,5-Dihydroxy-m-anisic acid gallic acid 3-methyl ether A member of the class of benzoic acids that is gallic acid in which the phenolic hydroxy group at position 3 is converted into the corresponding methyl ether. C8H8O5 COc1cc(C(=O)O)cc(O)c1O CHEBI:28647 CHEBI:1615 3,4-dihydroxy-5-methoxybenzoic acid InChI=1S/C8H8O5/c1-13-6-3-4(8(11)12)2-5(9)7(6)10/h2-3,9-10H,1H3,(H,11,12) chebi_ontology reaxys:2695762 cas:3934-84-7 kegg.compound:C05616