is conjugate base of (S)-2-methylbutanoate InChI=1S/C5H10O2/c1-3-4(2)5(6)7/h4H,3H2,1-2H3,(H,6,7)/p-1/t4-/m0/s1 101.126 chebi_ontology (S)-2-methylbutyrate (2S)-2-methylbutyric acid anion C5H9O2 101.06080 PMID:16819884 (2S)-2-methylbutanoate -1 (S)-2-methylbutanoate [O-]C([C@H](CC)C)=O WLAMNBDJUVNPJU-BYPYZUCNSA-M CHEBI:145932 (S)-alpha-methylbutyrate A branched-chain saturated fatty acid anion resulting from the deprotonation of the carboxy group of (S)-2-methylbutanoic acid. The major species at pH 7.3. (2S)-2-methylbutyrate (S)-2-methylbutyric acid short-chain fatty acid anion branched-chain saturated fatty acid anion 2-methyl fatty acid anion