steroid C21-steroid 0 InChI=1S/C21H36/c1-4-15-9-11-18-17-10-8-16-7-5-6-13-20(16,2)19(17)12-14-21(15,18)3/h15-19H,4-14H2,1-3H3 chebi_ontology JWMFYGXQPXQEEM-UHFFFAOYSA-N C21H36 A steroid that has a structure based on a 21-carbon (pregnane) skeleton. Note that individual examples may have ring substituents at other positions and/or contain double bonds, aromatic A-rings, expanded/contracted rings etc., so the formula and mass may vary from that given for the generic structure. a C21-steroid CHEBI:61313 288.28170 C1CCCC2C1(C3C(CC2)C4C(CC3)(C(CC4)CC)C)C 288.511