has role volatile organic compound acetone ACETONE KEGG:D02311 InChI=1S/C3H6O/c1-3(2)4/h1-2H3 58.07914 Pyroacetic ether dimethylketone dimethylcetone 58.04186 KEGG:C00207 propanone chebi_ontology Propanon 2-Propanone MetaCyc:ACETONE CHEBI:15347 C3H6O UM-BBD_compID:c0556 Wikipedia:Acetone Dimethyl ketone Azeton CHEBI:40571 0 PMID:17190852 Beilstein:635680 LIPID_MAPS_instance:LMFA12000057 beta-Ketopropane propan-2-one CHEBI:13708 CHEBI:22182 HMDB:HMDB0001659 acetone Gmelin:1466 CC(C)=O methyl ketone PMID:17347819 CAS:67-64-1 PDBeChem:ACN CSCPPACGZOOCGX-UHFFFAOYSA-N CHEBI:2398 A methyl ketone that consists of propane bearing an oxo group at C2. Acetone Reaxys:635680 Aceton Dimethylketon propanones polar aprotic solvent methyl ketone methyl ketone ketone body human metabolite EC 3.5.1.4 (amidase) inhibitor