has part has part has_part has role cysteine cisteina 0 121.01975 Cystein chebi_ontology Cysteine KNApSAcK:C00001351 NC(CS)C(O)=O Beilstein:1721406 Wikipedia:Cysteine C CHEBI:15356 2-amino-3-sulfanylpropanoic acid CAS:3374-22-9 KEGG:C00736 CHEBI:14061 CHEBI:4050 XUJNEKJLAYXESH-UHFFFAOYSA-N 2-amino-3-mercaptopropanoic acid 121.15922 PMID:17439666 C3H7NO2S Gmelin:2933 KNApSAcK:C00007323 Zystein CHEBI:23508 cysteine Cys 2-Amino-3-mercaptopropionic acid PMID:25181601 A sulfur-containing amino acid that is propanoic acid with an amino group at position 2 and a sulfanyl group at position 3. Hcys InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6) Reaxys:1721406 polar amino acid sulfur-containing amino acid cysteinate(1-) cysteinium alpha-amino acid cysteine zwitterion sulfanylmethyl group fundamental metabolite