has role hexanoate hexoate capronate CCCCCC([O-])=O ECMDB:ECMDB21229 KEGG:C01585 115.15034 -1 A short-chain fatty acid anion that is the conjugate base of hexanoic acid (also known as caproic acid). hexylate butylacetate CHEBI:24569 nPnCO2 anion CH3-[CH2]4-COO(-) caproate InChI=1S/C6H12O2/c1-2-3-4-5-6(7)8/h2-5H2,1H3,(H,7,8)/p-1 pentanecarboxylate pentylformate 1-pentacarboxylate FUZZWVXGSFPDMH-UHFFFAOYSA-M n-hexoate 1-hexanoate n-hexanoate Gmelin:326340 Beilstein:3601453 chebi_ontology n-caproate MetaCyc:HEXANOATE 115.07645 CAS:151-33-7 CHEBI:14398 hexanoate 1-pentanecarboxylate n-hexylate C6H11O2 CHEBI:17120 hexanoic acid short-chain fatty acid anion straight-chain saturated fatty acid anion plant metabolite human metabolite fatty acid anion 6:0