has role octanoate C8H15O2 octanoate n-octanoate PMID:11983812 chebi_ontology octylate WWZKQHOCKIZLMA-UHFFFAOYSA-M InChI=1S/C8H16O2/c1-2-3-4-5-6-7-8(9)10/h2-7H2,1H3,(H,9,10)/p-1 n-octylate A straight-chain saturated fatty acid anion that is the conjugate base of octanoic acid (caprylic acid); believed to block adipogenesis. caprilate CH3-[CH2]6-COO(-) Gmelin:329219 -1 C(CCCCCC)C(=O)[O-] n-octoate UM-BBD_compID:c0047 Beilstein:3588079 octanoic acid, ion(1-) 143.204 1-heptanecarboxylate Reaxys:3588079 CAS:74-81-7 caprylate n-caprylate CHEBI:25646 143.10775 octanoic acid straight-chain saturated fatty acid anion Saccharomyces cerevisiae metabolite human metabolite fatty acid anion 8:0