has role omega-methyl-medium-chain fatty acid anion decanoate decanoate CHEBI:125804 C10H19O2 caprynate n-decanoate -1 KEGG:C01571 171.25670 caprinate decylate Beilstein:3538146 CHEBI:23570 chebi_ontology InChI=1S/C10H20O2/c1-2-3-4-5-6-7-8-9-10(11)12/h2-9H2,1H3,(H,11,12)/p-1 CHEBI:27689 decoate GHVNFZFCNZKVNT-UHFFFAOYSA-M 171.13905 nC9H19CO2 anion Gmelin:330643 Reaxys:3538146 n-decylate MetaCyc:CPD-3617 n-caprate CH3-[CH2]8-COO(-) A fatty acid anion 10:0 that is the conjugate base of decanoic acid. 1-nonanecarboxylate caprate n-decoate CCCCCCCCCC([O-])=O decanoic acid anion decanoic acid straight-chain saturated fatty acid anion Saccharomyces cerevisiae metabolite plant metabolite human metabolite fatty acid anion 10:0