has role nonanoic acid nonanoate 157.12340 CH3-[CH2]7-COO(-) -1 nonylate Gmelin:329987 n-nonanoate 1-nonanoate pergonate nonoate pelargonate FBUKVWPVBMHYJY-UHFFFAOYSA-M CHEBI:32361 chebi_ontology A medium-chain fatty acid anion that is the conjugate base of nonanoic acid that in methyl ester form has significant nematicidal activity. CCCCCCCCC([O-])=O pelargate 157.23060 1-octanecarboxylate C9H17O2 nonanoate Beilstein:3904165 InChI=1S/C9H18O2/c1-2-3-4-5-6-7-8-9(10)11/h2-8H2,1H3,(H,10,11)/p-1 straight-chain saturated fatty acid anion medium-chain fatty acid anion plant metabolite