has role volatile organic compound alkadiene hemiterpene isoprene Reaxys:969158 PMID:17921528 chebi_ontology beta-methylbivinyl MetaCyc:CPD-9436 PMID:19011917 RRHGJUQNOFWUDK-UHFFFAOYSA-N CH2=C(CH3)CH=CH2 Isopren PMID:8690002 CAS:78-79-5 2-methylbutadiene 68.06260 CHEBI:35194 2-methyldivinyl InChI=1S/C5H8/c1-4-5(2)3/h4H,1-2H2,3H3 68.11702 isopentadiene CC(=C)C=C Wikipedia:Isoprene Gmelin:1768 isopreno 2-Methyl-1,3-butadiene 2-methylbuta-1,3-diene C5H8 2-methyl-1,3-butadiene isoprene 0 isoterpene A hemiterpene with the formula CH2=C(CH3)CH=CH2; the monomer of natural rubber and a common structure motif to the isoprenoids, a large class of other naturally occurring compounds. Beilstein:969158 KEGG:C16521 plant metabolite