has role heptanoate straight-chain saturated fatty acid heptanoic acid Beilstein:1744723 C7H14O2 HMDB:HMDB0000666 Oenanthsaeure 0 heptoic acid LIPID_MAPS_instance:LMFA01010007 n-heptanoic acid CHEBI:24519 oenanthic acid CH3-[CH2]5-COOH Heptansaeure Reaxys:1744723 n-heptoic acid heptylic acid InChI=1S/C7H14O2/c1-2-3-4-5-6-7(8)9/h2-6H2,1H3,(H,8,9) chebi_ontology 130.18486 heptanoic acid CAS:111-14-8 MNWFXJYAOYHMED-UHFFFAOYSA-N 130.09938 enanthic acid CCCCCCC(O)=O A C7, straight-chain fatty acid that contributes to the odour of some rancid oils. Used in the preparation of esters for the fragrance industry, and as an additive in cigarettes. CHEBI:45571 MetaCyc:CPD-7619 CHEBI:45568 KEGG:C17714 enanthylic acid Gmelin:142428 PMID:23999410 n-heptylic acid HEPTANOIC ACID Wikipedia:Heptanoic_acid DrugBank:DB02938 oenanthylic acid PDBeChem:SHV medium-chain fatty acid plant metabolite