arsenite(1-) arsenic oxoacid arsenous acid trihydrogen trioxoarsenate(3-) GCPXMJHSNVMWNM-UHFFFAOYSA-N 0 Gmelin:1397624 InChI=1S/AsH3O3/c2-1(3)4/h2-4H 125.94362 trioxoarsenic acid KEGG:D02106 CAS:13464-58-9 chebi_ontology KEGG:C06697 CHEBI:49900 trihydroxidoarsenic AsH3O3 arsenous acid H3AsO3 125.92981 TRIHYDROXYARSENITE(III) Arsenic trioxide PDBeChem:TAS DrugBank:DB04456 arsorous acid An arsenic oxoacid consisting of three hydroxy groups attached to a central arsenic atom. UM-BBD_compID:c0532 CHEBI:22635 KEGG:C13619 As(OH)3 CHEBI:49899 [As(OH)3] CAS:1327-53-3 O[As](O)O