has role dialkyl ketone metabolite heptan-3-one Beilstein:506161 CHEBI:50139 CAS:106-35-4 Reaxys:506161 A dialkyl ketone with butyl and ethyl as the two alkyl groups. Ethyl-n-butyl ketone heptan-3-one 3-Heptanone Ethylbutylcetone Aethylbutylketon InChI=1S/C7H14O/c1-3-5-6-7(8)4-2/h3-6H2,1-2H3 114.10447 Ethyl n-butyl ketone 0 PMID:22284503 114.18546 HMDB:HMDB0031482 PMID:23870484 CCCCC(=O)CC Wikipedia:3-Heptanone C7H14O n-Butyl ethyl ketone Butyl ethyl ketone NGAZZOYFWWSOGK-UHFFFAOYSA-N chebi_ontology biomarker