has role dialkyl ketone pheromone methyl ketone methyl ketone heptan-2-one KEGG:C08380 114.18546 2-Heptanone PMID:20416794 PMID:16025460 heptan-2-one CHEBI:5672 Beilstein:1699063 A dialkyl ketone with methyl and pentyl as the alkyl groups. KNApSAcK:C00001254 Wikipedia:2-Heptanone PMID:2270874 InChI=1S/C7H14O/c1-3-4-5-6-7(2)8/h3-6H2,1-2H3 114.10447 CAS:110-43-0 C7H14O Methyl n-amyl ketone butylacetone chebi_ontology Reaxys:1699063 PMID:14759148 Gmelin:305860 n-amyl methyl ketone n-pentyl methyl ketone CCCCCC(C)=O CATSNJVOTSVZJV-UHFFFAOYSA-N 0 Heptan-2-one methyl pentyl ketone PMID:12769891 LIPID_MAPS_instance:LMFA12000004 mouse metabolite