has role glycolic acid monocarboxylic acid plant growth retardant aromatic ether phenoxyacetate allergen Aspergillus metabolite human xenobiotic metabolite phenoxyacetic acid PMID:26188115 HMDB:HMDB0031609 chebi_ontology CHEBI:8075 C8H8O3 A monocarboxylic acid that is the O-phenyl derivative of glycolic acid. A metabolite of 2-phenoxyethanol, it is used in the manufacture of pharmaceuticals, pesticides, fungicides and dyes. CAS:122-59-8 phenoxyacetic acid phenoxyethanoic acid Gmelin:142730 PMID:23838187 phenoxacetic acid POA Phenoxyacetate KEGG:C02181 PDBeChem:06Y Phenoxyacetic acid Phenoxyessigsaeure Glycol acid phenyl ether LCPDWSOZIOUXRV-UHFFFAOYSA-N PMID:14687482 OC(=O)COc1ccccc1 Beilstein:907949 InChI=1S/C8H8O3/c9-8(10)6-11-7-4-2-1-3-5-7/h1-5H,6H2,(H,9,10) PMID:26452788 152.04734 Reaxys:907949 152.14732 0