has role benzenes herbicide pyridazinone xenobiotic organochlorine compound organochlorine compound primary amino compound environmental contaminant chloridazon 5-amino-4-chloro-2-phenylpyridazin-3(2H)-one Pyrazonl KEGG:C18570 pyrazon WYKYKTKDBLFHCY-UHFFFAOYSA-N Reaxys:397241 Pesticides:chloridazon PMID:25149238 chebi_ontology CHEBI:81838 C10H8ClN3O A pyridazinone that is pyridazin-3(2H)-one substituted by an amino group at position 5, a chloro group at position 4 and a phenyl group at position 2. chloridazone 221.03559 Clorizol 221.64300 0 PMID:22575008 Curbetan PMID:23562547 CAS:1698-60-8 Nc1cnn(-c2ccccc2)c(=O)c1Cl InChI=1S/C10H8ClN3O/c11-9-8(12)6-13-14(10(9)15)7-4-2-1-3-5-7/h1-6H,12H2 PPDB:141 Patent:NZ244108