has role benzenes benzoic acid acyl chloride carcinogenic agent benzoyl chloride Wikipedia:Benzoyl_chloride 140.570 C7H5ClO InChI=1S/C7H5ClO/c8-7(9)6-4-2-1-3-5-6/h1-5H An acyl chloride consisting of benzene in which a hydrogen is replaced by an acyl chloride group. It is an important chemical intermediate for the manufacture of other chemicals, dyes, perfumes, herbicides and pharmaceuticals. KEGG:C19168 PMID:3820773 PMID:10476457 140.00289 PMID:1069541 CAS:98-88-4 alpha-chlorobenzaldehyde chebi_ontology benzoyl chloride PASDCCFISLVPSO-UHFFFAOYSA-N PMID:24471690 PMID:30372914 PMID:6957389 PMID:7327367 PMID:12371201 PMID:14833424 PMID:19697904 ClC(=O)C1=CC=CC=C1 PMID:533824 0 Reaxys:471389 benzoic acid chloride benzenecarbonyl chloride CHEBI:82275