has part has role is conjugate acid of is conjugate base of is tautomer of cysteine 0 121.020 121.15922 2-Amino-3-mercaptopropionic acid 2-amino-3-mercaptopropanoic acid 2-amino-3-sulfanylpropanoic acid A sulfur-containing amino acid that is propanoic acid with an amino group at position 2 and a sulfanyl group at position 3. Beilstein:1721406 C C3H7NO2S CAS:3374-22-9 CHEBI:14061 CHEBI:15356 CHEBI:23508 CHEBI:4050 Cys Cystein Cysteine Gmelin:2933 Hcys InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6) KEGG:C00736 KNApSAcK:C00001351 KNApSAcK:C00007323 NC(CS)C(O)=O PMID:17439666 PMID:25181601 Reaxys:1721406 Wikipedia:Cysteine XUJNEKJLAYXESH-UHFFFAOYSA-N Zystein chebi_ontology cisteina cysteine colombos:CYSTEINE colombos:CYSTEINE:+UNKNOWNg/L sulfur-containing amino acid cysteinate(1-) cysteinium alpha-amino acid cysteine zwitterion sulfanylmethyl group fundamental metabolite