has role is conjugate acid of salicylic acid 0 138.032 138.12070 2-HYDROXYBENZOIC ACID 2-carboxyphenol 2-hydroxybenzoic acid A monohydroxybenzoic acid that is benzoic acid with a hydroxy group at the ortho position. It is obtained from the bark of the white willow and wintergreen leaves. Beilstein:774890 C7H6O3 CAS:69-72-7 CHEBI:16914 CHEBI:26597 CHEBI:45521 CHEBI:9006 DrugBank:DB00936 Drug_Central:2416 Gmelin:3418 HMDB:HMDB01895 InChI=1S/C7H6O3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8H,(H,9,10) KEGG:C00805 KEGG:D00097 KNApSAcK:C00000206 LINCS:LSM-4763 MetaCyc:CPD-110 OC(=O)c1ccccc1O PDBeChem:SAL PMID:11016405 PMID:12865403 PMID:1650428 PMID:19400653 PMID:19816125 PMID:22770225 PMID:3425858 Reaxys:774890 Salicylic acid Wikipedia:Salicylic_Acid YGSDEFSMJLZEOE-UHFFFAOYSA-N chebi_ontology o-Hydroxybenzoic acid o-carboxyphenol o-hydroxybenzoic acid monohydroxybenzoic acid salicylate antiinfective agent antifungal agent plant hormone keratolytic drug EC 1.11.1.11 (L-ascorbate peroxidase) inhibitors plant metabolite algal metabolite