has role is conjugate acid of 2,3-dihydroxybenzoic acid 0 154.027 154.12010 2,3 DHB 2,3-DIHYDROXY-BENZOIC ACID 2,3-Dihydroxybenzoic acid 2,3-dihydroxybenzoic acid 2-pyrocatechuic acid 3-hydroxysalicylic acid A dihydroxybenzoic acid that is benzoic acid substituted by hydroxy groups at positions 2 and 3. It occurs naturally in Phyllanthus acidus and in the aquatic fern Salvinia molesta. Beilstein:2209117 C7H6O4 CAS:303-38-8 CHEBI:18026 CHEBI:19320 CHEBI:41901 CHEBI:885 DOBK DrugBank:DB01672 GLDQAMYCGOIJDV-UHFFFAOYSA-N HMDB:HMDB00397 InChI=1S/C7H6O4/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3,8-9H,(H,10,11) KEGG:C00196 KNApSAcK:C00002669 OC(=O)c1cccc(O)c1O PDBeChem:DBH PMID:17065237 PMID:24171385 PMID:3575393 Reaxys:2209117 Wikipedia:2,3-Dihydroxybenzoic_acid catechol-3-carboxylic acid chebi_ontology o-pyrocatechuic acid pyrocatechuic acid dihydroxybenzoic acid 2,3-dihydroxybenzoate plant metabolite human xenobiotic metabolite