has role is conjugate base of octanoate -1 1-heptanecarboxylate 143.107 143.204 A straight-chain saturated fatty acid anion that is the conjugate base of octanoic acid (caprylic acid); believed to block adipogenesis. Beilstein:3588079 C(CCCCCC)C(=O)[O-] C8H15O2 CAS:74-81-7 CH3-[CH2]6-COO(-) CHEBI:25646 Gmelin:329219 InChI=1S/C8H16O2/c1-2-3-4-5-6-7-8(9)10/h2-7H2,1H3,(H,9,10)/p-1 PMID:11983812 Reaxys:3588079 UM-BBD_compID:c0047 WWZKQHOCKIZLMA-UHFFFAOYSA-M caprilate caprylate chebi_ontology n-caprylate n-octanoate n-octoate n-octylate octanoate octanoic acid, ion(1-) octylate octanoic acid straight-chain saturated fatty acid anion Saccharomyces cerevisiae metabolite human metabolite fatty acid anion 8:0