volatile organic compound acetone 2-Propanone 58.042 58.07914 A methyl ketone that consists of propane bearing an oxo group at C2. ACETONE Aceton Acetone Azeton Beilstein:635680 C3H6O CAS:67-64-1 CC(C)=O CHEBI:13708 CHEBI:15347 CHEBI:22182 CHEBI:2398 CHEBI:40571 CSCPPACGZOOCGX-UHFFFAOYSA-N Dimethyl ketone Dimethylketon Gmelin:1466 HMDB:HMDB0001659 InChI=1S/C3H6O/c1-3(2)4/h1-2H3 KEGG:C00207 KEGG:D02311 LIPID_MAPS_instance:LMFA12000057 MetaCyc:ACETONE PDBeChem:ACN PMID:17190852 PMID:17347819 Propanon Pyroacetic ether Reaxys:635680 UM-BBD_compID:c0556 Wikipedia:Acetone acetone beta-Ketopropane chebi_ontology dimethylcetone dimethylketone methyl ketone propan-2-one propanone propanone methyl ketone ketone body