butane-2,3-dione 2,3-Butadione 2,3-Butanedione 2,3-Diketobutane 2,3-Dioxobutane 2,3-butandione 86.037 86.08924 An alpha-diketone that is butane substituted by oxo groups at positions 2 and 3. It is a metabolite produced during the malolactic fermentation. Beilstein:605398 Biacetyl C4H6O2 CAS:431-03-8 CC(=O)C(C)=O CHEBI:14134 CHEBI:16583 CHEBI:4479 Diacetyl Dimethyl glyoxal Dimethylglyoxal HMDB:HMDB0003407 InChI=1S/C4H6O2/c1-3(5)4(2)6/h1-2H3 KEGG:C00741 PMID:15654607 PMID:24614328 QSJXEFYPDANLFS-UHFFFAOYSA-N Reaxys:605398 butane-2,3-dione chebi_ontology diacetyl ketone