has functional parent is conjugate acid of 4-hydroxybutyrate 103.040 103.09658 4-hydroxybutanoate 4-hydroxybutanoate A 4-hydroxy monocarboxylic acid anion resulting from the removal of a proton from the carboxy group of 4-hydroxybutyric acid. Beilstein:3903887 C4H7O3 CHEBI:12006 CHEBI:16724 CHEBI:20401 DrugBank:DB01440 GHB Gmelin:1524032 InChI=1S/C4H8O3/c5-3-1-2-4(6)7/h5H,1-3H2,(H,6,7)/p-1 KEGG:C00989 OCCCC([O-])=O SJZRECIVHVDYJC-UHFFFAOYSA-M UM-BBD_compID:c0022 chebi_ontology gamma-hydroxybutyrate butyrate 4-hydroxybutyric acid hydroxy monocarboxylic acid anion short-chain fatty acid anion hydroxy fatty acid anion