is enantiomer of (R)-3-hydroxybutyric acid (3R)-3-hydroxybutanoic acid (R)-(-)-beta-hydroxybutyric acid (R)-3-Hydroxybutanoic acid (R)-3-Hydroxybutyric acid 104.047 104.10450 3-D-hydroxybutyric acid C4H8O3 CAS:625-72-9 CHEBI:17066 CHEBI:18666 CHEBI:322 C[C@@H](O)CC(O)=O D-3-hydroxybutyric acid HMDB:HMDB0000011 InChI=1S/C4H8O3/c1-3(5)2-4(6)7/h3,5H,2H2,1H3,(H,6,7)/t3-/m1/s1 KEGG:C01089 LIPID_MAPS_instance:LMFA01050243 MetaCyc:CPD-335 PMID:19304817 PMID:20699574 PMID:3679704 Patent:WO9312254 Reaxys:1720568 The R-enantiomer of 3-hydroxybutyric acid. Involved in the synthesis and degradation of ketone bodies, it can be used as an energy source by the brain during hypoglycaemia, and for the synthesis of biodegradable plastics. WHBMMWSBFZVSSR-GSVOUGTGSA-N chebi_ontology (S)-3-hydroxybutyric acid 3-hydroxybutyric acid ketone body