has role is conjugate base of dodecanoate 1-undecanecarboxylate 199.170 199.310 A medium-chain fatty acid anion that is the conjugate base of dodecanoic acid (lauric acid); major species at pH 7.3. Beilstein:3588839 C(CCCCCCCC)CCC([O-])=O C12 fatty acid anion C12H23O2 CH3-[CH2]10-COO(-) CHEBI:14187 CHEBI:18262 CHEBI:23863 Gmelin:333430 InChI=1S/C12H24O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3,(H,13,14)/p-1 KEGG:C02679 MetaCyc:DODECANOATE POULHZVOKOAJMA-UHFFFAOYSA-M Reaxys:3588839 chebi_ontology dodecanoate dodecoate dodecylate duodecyclate duodecylate laurate laurostearate n-dodecanoate undecane-1-carboxylate vulvate dodecanoic acid straight-chain saturated fatty acid anion medium-chain fatty acid anion omega-methyl fatty acid anion plant metabolite fatty acid anion 12:0