has functional parent is conjugate acid of 3-hydroxybutyric acid (1)-3-Hydroxybutyric acid 104.047 104.10452 3 HBA 3-Hydroxybuttersaeure 3-OH-butyric acid 3-hydroxybutanoic acid A straight-chain 3-hydroxy monocarboxylic acid comprising a butyric acid core with a single hydroxy substituent in the 3- position; a ketone body whose levels are raised during ketosis, used as an energy source by the brain during fasting in humans. Also used to synthesise biodegradable plastics. BHBA Beilstein:773861 C4H8O3 CAS:300-85-6 CC(O)CC(O)=O CHEBI:20067 DL-beta-Hydroxybutyric acid HMDB:HMDB0000357 InChI=1S/C4H8O3/c1-3(5)2-4(6)7/h3,5H,2H2,1H3,(H,6,7) LIPID_MAPS_instance:LMFA01050005 PMID:10855969 PMID:17190852 PMID:17579249 PMID:6061736 Reaxys:773861 WHBMMWSBFZVSSR-UHFFFAOYSA-N Wikipedia:3-hydroxybutyrate beta-Hydroxy-n-butyric acid beta-Hydroxybuttersaeure beta-hydroxy-n-butyric acid beta-hydroxybutanoic acid beta-hydroxybutyric acid chebi_ontology hydroxybutyric acid butyric acid 3-hydroxy monocarboxylic acid 3-hydroxybutyrate (omega-1)-hydroxy fatty acid