has functional parent lysine 146.106 146.18764 2,6-diaminohexanoic acid A diamino acid that is caproic (hexanoic) acid bearing two amino substituents at positions 2 and 6. Beilstein:1616991 C6H14N2O2 CAS:70-54-2 CHEBI:25094 Gmelin:279284 InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10) K KDXKERNSBIXSRK-UHFFFAOYSA-N KEGG:C16440 LYS Lysin NCCCCC(N)C(O)=O PMID:17439666 PMID:22264337 Reaxys:1616991 Wikipedia:Lysine alpha,epsilon-diaminocaproic acid chebi_ontology lysine hexanoic acid alpha-amino acid diamino acid