has functional parent is conjugate acid of chemical entity 3-phenyllactic acid 166.063 166.17390 2-hydroxy-3-phenylpropanoic acid 2-hydroxy-3-phenylpropionic acid A 2-hydroxy monocarboxylic acid that is lactic acid in which one of the methyl hydrogens is substituted by a phenyl group. C9H10O3 CAS:828-01-3 CHEBI:25998 DL-3-phenyllactic acid DL-beta-phenyllactic acid HMDB:HMDB0000779 InChI=1S/C9H10O3/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,11,12) MetaCyc:CPD-7999 OC(Cc1ccccc1)C(O)=O PMID:22770225 Reaxys:2209791 VOXXWSYKYCBWHO-UHFFFAOYSA-N beta-phenyllactic acid chebi_ontology rac-lactic acid 2-hydroxy monocarboxylic acid 3-phenyllactate