has role ethyl ester metabolite ethyl acetate 1-acetoxyethane 88.052 88.10512 AcOEt Acetyl ester Beilstein:506104 C4H8O2 CAS:141-78-6 CCOC(C)=O CH3-CO-O-CH3 CHEBI:2389 CHEBI:23989 CHEBI:27750 CHEBI:42244 ETHYL ACETATE Essigester Essigsaeureethylester EtOAc Ethyl acetate Ethylacetat Ethylazetat Gmelin:26306 HMDB:HMDB0031217 InChI=1S/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3 KEGG:C00849 KEGG:C01883 KEGG:D02319 KNApSAcK:C00001308 PDBeChem:EEE PMID:11684179 PMID:15497757 PMID:21764274 PMID:21797203 PMID:23078109 PMID:23089728 PMID:23108979 PMID:23351147 PMID:23614288 Reaxys:506104 The acetate ester formed between acetic acid and ethanol. UM-BBD_compID:c0036 Wikipedia:Ethyl_acetate XEKOWRVHYACXOJ-UHFFFAOYSA-N acetic acid ethyl ester acetic acid, ethyl ester acetic ester acetoxyethane chebi_ontology ethyl acetate ethyl acetic ester ethyl ethanoate vinegar naphtha acetate ester organic molecule