is conjugate acid of is conjugate base of is enantiomer of glutamate(1-) L-glutamic acid L-glutamate(1-) (2S)-2-ammoniopentanedioate 146.045 146.12136 An alpha-amino-acid anion that is the conjugate base of L-glutamic acid, having anionic carboxy groups and a cationic amino group C5H8NO4 CAS:11070-68-1 CHEBI:13107 CHEBI:21301 CHEBI:29985 Gmelin:936654 InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/p-1/t3-/m0/s1 L-glutamate L-glutamate(1-) L-glutamic acid monoanion L-glutamic acid, ion(1-) MetaCyc:GLT WHUUTDBJXJRKMK-VKHMYHEASA-M [NH3+][C@@H](CCC([O-])=O)C([O-])=O chebi_ontology hydrogen L-glutamate D-glutamate(1-) L-glutamate(2-) polar amino acid zwitterion