is conjugate acid of is conjugate base of is enantiomer of glutamate(1-) D-glutamic acid L-glutamate(1-) D-glutamate(1-) (2R)-2-ammoniopentanedioate 146.045 146.12136 An alpha-amino-acid anion that is the conjugate base of D-glutamic acid, having anionic carboxy groups and a cationic amino group Beilstein:8319427 C5H8NO4 CHEBI:12979 CHEBI:21022 CHEBI:29986 D-glutamate D-glutamate(1-) D-glutamic acid monoanion InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/p-1/t3-/m1/s1 MetaCyc:D-GLT WHUUTDBJXJRKMK-GSVOUGTGSA-M [NH3+][C@H](CCC([O-])=O)C([O-])=O chebi_ontology hydrogen D-glutamate D-glutamate(2-)