is conjugate acid of butyrate short-chain fatty acid butyric acid 1-butanoic acid 1-butyric acid 1-propanecarboxylic acid 4:0 88.052 88.10510 A straight-chain saturated fatty acid that is butane in which one of the terminal methyl groups has been oxidised to a carboxy group. BUTANOIC ACID Beilstein:906770 Butanoate Butanoic acid Buttersaeure Butyric acid C4:0 C4H8O2 CAS:107-92-6 CCCC(O)=O CH3-[CH2]2-COOH CHEBI:113450 CHEBI:22948 CHEBI:30772 CHEBI:3234 CHEBI:41208 DrugBank:DB03568 FERIUCNNQQJTOY-UHFFFAOYSA-N Gmelin:26242 HMDB:HMDB0000039 InChI=1S/C4H8O2/c1-2-3-4(5)6/h2-3H2,1H3,(H,5,6) KEGG:C00246 KNApSAcK:C00001180 LIPID_MAPS_instance:LMFA01010004 MetaCyc:BUTYRIC_ACID PDBeChem:BUA PMID:10736622 PMID:10956204 PMID:11201044 PMID:11208715 PMID:11238216 PMID:11305323 PMID:12068484 PMID:13678314 PMID:14962641 PMID:1542095 PMID:15809727 PMID:15810631 PMID:15938880 PMID:19318247 PMID:19366864 PMID:19703412 PMID:21699495 PMID:22038864 PMID:22194341 PMID:22322557 PMID:22339023 PMID:22466881 Reaxys:906770 Wikipedia:Butyric_acid acide butanoique acide butyrique butanic acid butanoic acid butanoic acid butoic acid butyric acid chebi_ontology ethylacetic acid n-butanoic acid n-butyric acid propanecarboxylic acid propylformic acid straight-chain saturated fatty acid