has functional parent is conjugate acid of is tautomer of enol-phenylpyruvate acrylic acid keto-phenylpyruvic acid enol-phenylpyruvic acid 164.047 164.15802 2-hydroxy-3-phenylacrylic acid 2-hydroxy-3-phenylprop-2-enoic acid A 2-hydroxy monocarboxylic acid that is the enol-form of phenylpyruvic acid, consisting of acrylic acid having a hydroxy substituent at the 2-position and a phenyl group at the 3-position. Beilstein:2413207 C9H8O3 CHEBI:10548 CHEBI:23914 CHEBI:23915 CHEBI:32815 DEDGUGJNLNLJSR-UHFFFAOYSA-N InChI=1S/C9H8O3/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-6,10H,(H,11,12) KEGG:C02763 OC(=O)C(O)=Cc1ccccc1 Reaxys:2413207 chebi_ontology enol-Phenylpyruvate enol-Phenylpyruvic acid enol-alpha-Ketohydrocinnamic acid 2-hydroxy monocarboxylic acid alpha,beta-unsaturated monocarboxylic acid