is conjugate acid of hexadienoic acid monocarboxylic acid polyunsaturated fatty acid sorbic acid (2-butenylidene) acetic acid 112.052 112.12652 2,4-Hexadiensaeure 2,4-SA 2,4-hexadienoic acid 2-propenylacrylic acid A hexadienoic acid with double bonds at C-2 and C-4; it has four geometrical isomers, of which the trans,trans-form is naturally occurring. Beilstein:1741831 C6H8O2 CAS:22500-92-1 CHEBI:35962 InChI=1S/C6H8O2/c1-2-3-4-5-6(7)8/h2-5H,1H3,(H,7,8) PMID:11206806 SA Sorbinsaeure WSWCOQWTEOXDQX-UHFFFAOYSA-N [H]C(C)=CC([H])=CC(O)=O chebi_ontology crotylidene acetic acid hexa-2,4-dienoic acid sorbate medium-chain fatty acid