has role hydroxycinnamic acid catechols caffeic acid 180.042 180.15740 3-(3,4-dihydroxyphenyl)prop-2-enoic acid A hydroxycinnamic acid that is cinnamic acid in which the phenyl ring is substituted by hydroxy groups at positions 3 and 4. It exists in cis and trans forms; the latter is the more common. Beilstein:2210883 C9H8O4 CHEBI:36281 HMDB:HMDB0001964 InChI=1S/C9H8O4/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1-5,10-11H,(H,12,13) KEGG:C01481 LINCS:LSM-5272 OC(=O)C=Cc1ccc(O)c(O)c1 PMID:11373473 PMID:15778121 PMID:18061431 PMID:18314336 PMID:18482095 PMID:20542693 PMID:8340025 QAIPRVGONGVQAS-UHFFFAOYSA-N Reaxys:2210883 chebi_ontology plant metabolite