is conjugate acid of aminobenzoic acid 5-nitroanthranilate 5-nitroanthranilic acid 1-amino-2-carboxy-4-nitrobenzene 182.033 182.13350 2-amino-5-nitrobenzoic acid An aminobenzoic acid in which the the amino group is ortho- to the carboxylic acid group, and which is substituted para- to the amino group by a nitro group. C7H6N2O4 CAS:616-79-5 CHEBI:61280 InChI=1S/C7H6N2O4/c8-6-2-1-4(9(12)13)3-5(6)7(10)11/h1-3H,8H2,(H,10,11) Nc1ccc(cc1C(O)=O)[N+]([O-])=O PMID:20081004 RUCHWTKMOWXHLU-UHFFFAOYSA-N Reaxys:646219 chebi_ontology