has role metabolite monoalkyl-sn-glycero-3-phosphocholine lysophosphatidylcholine O-18:1 507.369 A monoalkylglycerophosphocholine in which the alkyl group contains 18 carbons and one double bond. If R1 is an alkenyl group and R2 is a hydrogen then the molecule is a 1-alkenyl-sn-glycero-3-phosphocholine. If R1 is a hydrogen and R2 is an alkenyl group then the molecule is a 2-alkenyl-sn-glycero-3-phosphocholine. C26H54NO6P CHEBI:64591 GPCho(O-18:1) LPC O-18:1 LysoPC(O-18:1) PC O-18:1_0:0 PMID:19347970 [H][C@@](COC)(COP([O-])(=O)OCC[N+](C)(C)C)OC chebi_ontology