benzaldehydes benzoic acids benzophenones resorcinols TAN-931 302.043 302.23570 4-(2,6-dihydroxybenzoyl)-3-formyl-5-hydroxybenzoic acid A member of the class of benzoic acids that is benzoic acid substituted by a formyl group at position 3, a hydroxy group at position 5 and a 2,6-dihydroxybenzoyl group at position 4. Isolated from Penicillium purpurogenum, it exhibits antiviral activity. C15H10O7 CAS:127448-92-4 CHEBI:69475 INVAPAXTQZQLGN-UHFFFAOYSA-N InChI=1S/C15H10O7/c16-6-8-4-7(15(21)22)5-11(19)12(8)14(20)13-9(17)2-1-3-10(13)18/h1-6,17-19H,(H,21,22) OC(=O)c1cc(O)c(C(=O)c2c(O)cccc2O)c(C=O)c1 PMID:2071487 PMID:2071488 PMID:21879714 Patent:EP0342665 Reaxys:21878450 Tan 931 chebi_ontology