is conjugate acid of branched-chain saturated fatty acid medium-chain fatty acid methyl-branched fatty acid isocaproic acid 116.084 116.15830 4,4-Dimethylbutanoic acid 4-Methyl-N-valeric acid 4-Methyl-Valeric acid 4-Methyl-pentanoic acid 4-Methylvaleric acid 4-methylpentanoic acid A methyl-branched fatty acid that is pentanoic acid with a methyl group substituent at position 4. It is a metabolite of 20 alpha-hydroxycholesterol C6H12O2 CAS:646-07-1 CC(C)CCC(O)=O CHEBI:40106 CHEBI:74903 DrugBank:DB03993 FGKJLKRYENPLQH-UHFFFAOYSA-N HMDB:HMDB0000689 InChI=1S/C6H12O2/c1-5(2)3-4-6(7)8/h5H,3-4H2,1-2H3,(H,7,8) Isobutylacetic acid Isocaproic acid Isohexanoic acid Isohexoic acid LIPID_MAPS_instance:LMFA01020076 PDBeChem:4MV PMID:14446007 Reaxys:1741912 chebi_ontology isocaproate