medium-chain fatty acid anion aldehydic acid anion omega-oxo fatty acid anion 9-oxononanoate 171.102 171.21410 9-ketononanoate 9-oxononanoate An aldehydic acid anion that is the conjugate base of 9-oxononanoic acid, obtained by deprotonation of the carboxy group; major species at pH 7.3. C9H15O3 CHEBI:77812 InChI=1S/C9H16O3/c10-8-6-4-2-1-3-5-7-9(11)12/h8H,1-7H2,(H,11,12)/p-1 MetaCyc:CPD-8686 PMID:2040620 PMID:23704812 PMID:23934656 PMID:2892534 Reaxys:23888971 WLGDDELKYAWBBL-UHFFFAOYSA-M [O-]C(=O)CCCCCCCC=O chebi_ontology