is conjugate base of henicosanoic acid long-chain fatty acid anion straight-chain saturated fatty acid anion henicosanoate 325.311 325.54960 A long-chain fatty acid anion resulting from the deprotonation of the carboxy group of henicosanoic acid. Major species at pH 7.3. C21H41O2 CCCCCCCCCCCCCCCCCCCCC([O-])=O CHEBI:78797 CKDDRHZIAZRDBW-UHFFFAOYSA-M InChI=1S/C21H42O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(22)23/h2-20H2,1H3,(H,22,23)/p-1 Reaxys:3670885 chebi_ontology henicosanoate fatty acid anion 21:0