hydroxy fatty acid short-chain fatty acid branched-chain saturated fatty acid 2-ethylhydracrylic acid 118.063 118.13110 2-(Hydroxymethyl)-Butyric acid 2-(hydroxymethyl)butanoic acid 2-Ethylhydracrylic acid 3-Hydroxy-2-ethylpropanoic acid A branched-chain saturated fatty acid that is butanoic acid substituted by a hydroxymethyl group at position 2. It is a metabolite derived from the isoleucine metabolism. C5H10O3 CAS:4374-62-3 CCC(CO)C(O)=O CHEBI:82956 HMDB:HMDB0000396 InChI=1S/C5H10O3/c1-2-4(3-6)5(7)8/h4,6H,2-3H2,1H3,(H,7,8) PMID:1016232 PMID:15615815 PMID:4458986 PMID:759179 Reaxys:1747119 ZMZQVAUJTDKQGE-UHFFFAOYSA-N beta-Hydroxy-alpha-ethylpropionic acid chebi_ontology