has role morphine InChI=1S/C17H19NO3/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18/h2-5,10-11,13,16,19-20H,6-8H2,1H3/t10-,11+,13-,16-,17-/m0/s1 285.13649 0 C17H19NO3 BQJCRHHNABKAKU-KBQPJGBKSA-N 285.33770 [H][C@]12C=C[C@H](O)[C@@H]3Oc4c(O)ccc5C[C@H]1N(C)CC[C@@]23c45 A morphinane alkaloid that is a highly potent opiate analgesic psychoactive drug. Morphine acts directly on the central nervous system (CNS) to relieve pain but has a high potential for addiction, with tolerance and both physical and psychological dependence developing rapidly. Morphine is the most abundant opiate found in Papaver somniferum (the opium poppy). geroprotector morphinane alkaloid opioid analgesic vasodilator agent morphinan xenobiotic organic heteropentacyclic compound anaesthetic tertiary amino compound mu-opioid receptor agonist morphine(1+) plant metabolite environmental contaminant drug allergen