has role paeonilactinone (1R,4S,5R)-4-(hydroxymethyl)-6,6-dimethylbicyclo[3.1.1]heptan-2-one 168.233 A cyclic monoterpene ketone that is bicyclo[3.1.1]heptan-2-one which is substituted at positions 4, 6, and 6 by hydroxymethyl, methyl, and methyl groups (the 1R,4S,5R stereoisomer). It has been found in Japanese Paeoniae Radix, which has been used in various Chinese medicinal preparations as an anodyne, sedative, antispasmodic, and astringent. C10H16O2 CC1(C)[C@]2([C@](CC([C@@]1(C2)[H])=O)(CO)[H])[H] CHEBI:132796 InChI=1S/C10H16O2/c1-10(2)7-4-8(10)9(12)3-6(7)5-11/h6-8,11H,3-5H2,1-2H3/t6-,7-,8+/m1/s1 PMID:27313650 PMID:8814958 Pubchem:68588302 ZRBRUAVSMJRQMW-PRJMDXOYSA-N chebi_ontology primary alcohol cyclic monoterpene ketone monoterpenoid carbobicyclic compound plant metabolite