has role is conjugate base of tetradecanoic acid tetradecanoate 1-tetradecanecarboxylate 227.364 A long-chain fatty acid anion that is the conjugate base of myristic acid; major species at pH 7.3. Beilstein:3589340 C(CCCCCCCC)CCCCC([O-])=O C14H27O2 CH3-[CH2]12-COO(-) CHEBI:30807 CHEBI:35292 Gmelin:335122 InChI=1S/C14H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2,1H3,(H,15,16)/p-1 KEGG:C06424 Reaxys:3589340 TUNFSRHWOTWDNC-UHFFFAOYSA-M Tetradecanoate chebi_ontology myristate n-tetradecan-1-oate n-tetradecoate tetradecanoate tetradecoate long-chain fatty acid anion straight-chain saturated fatty acid anion Saccharomyces cerevisiae metabolite human metabolite fatty acid anion 14:0